C29H32N4O2S — CID 19639666
2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide (PubChem CID 19639666) has the molecular formula C29H32N4O2S and a molecular weight of 500.67 g/mol. Its IUPAC name is 2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 19639666 |
| Molecular Formula | C29H32N4O2S |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc3ccccc23)nnc1C(C)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H32N4O2S/c1-6-18-33-27(20(2)35-23-16-14-22(15-17-23)29(3,4)5)31-32-28(33)36-19-26(34)30-25-13-9-11-21-10-7-8-12-24(21)25/h6-17,20H,1,18-19H2,2-5H3,(H,30,34) |
| InChIKey | RFTQDDFNXIGFKO-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|