C25H22F2N4O2S — CID 19635712
2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide (PubChem CID 19635712) has the molecular formula C25H22F2N4O2S and a molecular weight of 480.54 g/mol. Its IUPAC name is 2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 19635712 |
| Molecular Formula | C25H22F2N4O2S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc3ccccc23)nnc1C(C)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C25H22F2N4O2S/c1-3-13-31-24(16(2)33-22-12-11-18(26)14-20(22)27)29-30-25(31)34-15-23(32)28-21-10-6-8-17-7-4-5-9-19(17)21/h3-12,14,16H,1,13,15H2,2H3,(H,28,32) |
| InChIKey | SKAKRPHQAKEGII-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|