C21H17Cl4FN4O2S — CID 19640988
2-[[5-[1-(2-chloro-4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 19640988) has the molecular formula C21H17Cl4FN4O2S and a molecular weight of 550.27 g/mol. Its IUPAC name is 2-[[5-[1-(2-chloro-4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[5-[1-(2-chloro-4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 19640988 |
| Molecular Formula | C21H17Cl4FN4O2S |
| Molecular Weight | 550.27 g/mol |
| Exact Mass | 547.98 |
| IUPAC Name | 2-[[5-[1-(2-chloro-4-fluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1C(C)Oc1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H17Cl4FN4O2S/c1-3-6-30-20(11(2)32-18-5-4-12(26)7-16(18)25)28-29-21(30)33-10-19(31)27-17-9-14(23)13(22)8-15(17)24/h3-5,7-9,11H,1,6,10H2,2H3,(H,27,31) |
| InChIKey | HJDPPDNGUAESPF-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.27 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|