C23H22F2N4O3S — CID 19635708
N-(4-acetylphenyl)-2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19635708) has the molecular formula C23H22F2N4O3S and a molecular weight of 472.52 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-acetylphenyl)-2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19635708 |
| Molecular Formula | C23H22F2N4O3S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-(4-acetylphenyl)-2-[[5-[1-(2,4-difluorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(C(C)=O)cc2)nnc1C(C)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C23H22F2N4O3S/c1-4-11-29-22(15(3)32-20-10-7-17(24)12-19(20)25)27-28-23(29)33-13-21(31)26-18-8-5-16(6-9-18)14(2)30/h4-10,12,15H,1,11,13H2,2-3H3,(H,26,31) |
| InChIKey | XABPBEVQLMSAFY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|