C21H18BrCl3N4O2S — CID 19638154
2-[[5-[1-(4-bromophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 19638154) has the molecular formula C21H18BrCl3N4O2S and a molecular weight of 576.73 g/mol. Its IUPAC name is 2-[[5-[1-(4-bromophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[5-[1-(4-bromophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 19638154 |
| Molecular Formula | C21H18BrCl3N4O2S |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 573.94 |
| IUPAC Name | 2-[[5-[1-(4-bromophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1C(C)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H18BrCl3N4O2S/c1-3-8-29-20(12(2)31-14-6-4-13(22)5-7-14)27-28-21(29)32-11-19(30)26-18-10-16(24)15(23)9-17(18)25/h3-7,9-10,12H,1,8,11H2,2H3,(H,26,30) |
| InChIKey | FXMZRDVGSLGIAX-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|