C22H22Cl2N4O3S — CID 17307017
N-(2,5-dichlorophenyl)-2-[[5-[1-(4-methoxyphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17307017) has the molecular formula C22H22Cl2N4O3S and a molecular weight of 493.42 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[[5-[1-(4-methoxyphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[[5-[1-(4-methoxyphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17307017 |
| Molecular Formula | C22H22Cl2N4O3S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[[5-[1-(4-methoxyphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)ccc2Cl)nnc1C(C)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H22Cl2N4O3S/c1-4-11-28-21(14(2)31-17-8-6-16(30-3)7-9-17)26-27-22(28)32-13-20(29)25-19-12-15(23)5-10-18(19)24/h4-10,12,14H,1,11,13H2,2-3H3,(H,25,29) |
| InChIKey | DJBVHKBELYYVPM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|