C25H29N5O2S — CID 126359375
N-[(1R)-1-[5-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-4-methylbenzamide (PubChem CID 126359375) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is N-[(1R)-1-[5-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-4-methylbenzamide.
| Compound Name | N-[(1R)-1-[5-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 126359375 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | N-[(1R)-1-[5-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-4-methylbenzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(CC)cc2)nnc1[C@@H](C)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H29N5O2S/c1-5-15-30-23(18(4)26-24(32)20-11-7-17(3)8-12-20)28-29-25(30)33-16-22(31)27-21-13-9-19(6-2)10-14-21/h5,7-14,18H,1,6,15-16H2,2-4H3,(H,26,32)(H,27,31)/t18-/m1/s1 |
| InChIKey | SFEZUNFJYOMKAY-GOSISDBHSA-N |
| XLogP | 4.56 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|