C23H23Cl2N5O2S — CID 126364929
N-[(1R)-1-[5-[2-(2,5-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-3-methylbenzamide (PubChem CID 126364929) has the molecular formula C23H23Cl2N5O2S and a molecular weight of 504.44 g/mol. Its IUPAC name is N-[(1R)-1-[5-[2-(2,5-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-3-methylbenzamide.
| Compound Name | N-[(1R)-1-[5-[2-(2,5-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 126364929 |
| Molecular Formula | C23H23Cl2N5O2S |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | N-[(1R)-1-[5-[2-(2,5-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-3-methylbenzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)ccc2Cl)nnc1[C@@H](C)NC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C23H23Cl2N5O2S/c1-4-10-30-21(15(3)26-22(32)16-7-5-6-14(2)11-16)28-29-23(30)33-13-20(31)27-19-12-17(24)8-9-18(19)25/h4-9,11-12,15H,1,10,13H2,2-3H3,(H,26,32)(H,27,31)/t15-/m1/s1 |
| InChIKey | OAXOSSWYNJCCDH-OAHLLOKOSA-N |
| XLogP | 5.30 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|