C22H20Cl2N6O4S — CID 21379327
3-chloro-N-[1-[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 21379327) has the molecular formula C22H20Cl2N6O4S and a molecular weight of 535.41 g/mol. Its IUPAC name is 3-chloro-N-[1-[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 3-chloro-N-[1-[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 21379327 |
| Molecular Formula | C22H20Cl2N6O4S |
| Molecular Weight | 535.41 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 3-chloro-N-[1-[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)nnc1C(C)NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H20Cl2N6O4S/c1-3-9-29-20(13(2)25-21(32)14-5-4-6-15(23)10-14)27-28-22(29)35-12-19(31)26-18-11-16(30(33)34)7-8-17(18)24/h3-8,10-11,13H,1,9,12H2,2H3,(H,25,32)(H,26,31) |
| InChIKey | HYCQPGVJENGQSM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|