C20H18Cl2N6O4S — CID 126361954
4-chloro-N-[(1R)-1-[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 126361954) has the molecular formula C20H18Cl2N6O4S and a molecular weight of 509.38 g/mol. Its IUPAC name is 4-chloro-N-[(1R)-1-[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[(1R)-1-[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126361954 |
| Molecular Formula | C20H18Cl2N6O4S |
| Molecular Weight | 509.38 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | 4-chloro-N-[(1R)-1-[5-[2-(2-chloro-5-nitroanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(Cl)cc1)c1nnc(SCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)n1C |
| InChI | InChI=1S/C20H18Cl2N6O4S/c1-11(23-19(30)12-3-5-13(21)6-4-12)18-25-26-20(27(18)2)33-10-17(29)24-16-9-14(28(31)32)7-8-15(16)22/h3-9,11H,10H2,1-2H3,(H,23,30)(H,24,29)/t11-/m1/s1 |
| InChIKey | GZXXNGRZXLSJNA-LLVKDONJSA-N |
| XLogP | 4.25 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|