C23H25ClN6O4S — CID 41009589
4-chloro-N-[(1R)-2-methyl-1-[4-methyl-5-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]benzamide (PubChem CID 41009589) has the molecular formula C23H25ClN6O4S and a molecular weight of 517.01 g/mol. Its IUPAC name is 4-chloro-N-[(1R)-2-methyl-1-[4-methyl-5-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]benzamide.
| Compound Name | 4-chloro-N-[(1R)-2-methyl-1-[4-methyl-5-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]benzamide |
|---|---|
| PubChem CID | 41009589 |
| Molecular Formula | C23H25ClN6O4S |
| Molecular Weight | 517.01 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 4-chloro-N-[(1R)-2-methyl-1-[4-methyl-5-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]benzamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nnc([C@H](NC(=O)c2ccc(Cl)cc2)C(C)C)n1C |
| InChI | InChI=1S/C23H25ClN6O4S/c1-13(2)20(26-22(32)15-5-7-16(24)8-6-15)21-27-28-23(29(21)4)35-12-19(31)25-18-10-9-17(30(33)34)11-14(18)3/h5-11,13,20H,12H2,1-4H3,(H,25,31)(H,26,32)/t20-/m1/s1 |
| InChIKey | HEGOCVFJBPIRDY-HXUWFJFHSA-N |
| XLogP | 4.54 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.01 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|