C24H26N6O6S — CID 4307840
N-[2-methyl-1-[4-methyl-5-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 4307840) has the molecular formula C24H26N6O6S and a molecular weight of 526.58 g/mol. Its IUPAC name is N-[2-methyl-1-[4-methyl-5-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-methyl-1-[4-methyl-5-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4307840 |
| Molecular Formula | C24H26N6O6S |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | N-[2-methyl-1-[4-methyl-5-[2-(2-methyl-4-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nnc(C(NC(=O)c2ccc3c(c2)OCO3)C(C)C)n1C |
| InChI | InChI=1S/C24H26N6O6S/c1-13(2)21(26-23(32)15-5-8-18-19(10-15)36-12-35-18)22-27-28-24(29(22)4)37-11-20(31)25-17-7-6-16(30(33)34)9-14(17)3/h5-10,13,21H,11-12H2,1-4H3,(H,25,31)(H,26,32) |
| InChIKey | YHVHVRZTWQIESD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 150.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|