C23H24N6O6S — CID 126147411
4-[[2-[[4-methyl-5-[(1R)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid (PubChem CID 126147411) has the molecular formula C23H24N6O6S and a molecular weight of 512.55 g/mol. Its IUPAC name is 4-[[2-[[4-methyl-5-[(1R)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[[4-methyl-5-[(1R)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 126147411 |
| Molecular Formula | C23H24N6O6S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 4-[[2-[[4-methyl-5-[(1R)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid |
| SMILES | CC(C)[C@@H](NC(=O)c1cccc([N+](=O)[O-])c1)c1nnc(SCC(=O)Nc2ccc(C(=O)O)cc2)n1C |
| InChI | InChI=1S/C23H24N6O6S/c1-13(2)19(25-21(31)15-5-4-6-17(11-15)29(34)35)20-26-27-23(28(20)3)36-12-18(30)24-16-9-7-14(8-10-16)22(32)33/h4-11,13,19H,12H2,1-3H3,(H,24,30)(H,25,31)(H,32,33)/t19-/m1/s1 |
| InChIKey | HNHWUFQWUUXHEI-LJQANCHMSA-N |
| XLogP | 3.28 |
| TPSA | 169.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|