C22H25N7O4S — CID 126130683
N-[(1R)-2-methyl-1-[4-methyl-5-[2-[(3-methyl-2-pyridinyl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-3-nitrobenzamide (PubChem CID 126130683) has the molecular formula C22H25N7O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is N-[(1R)-2-methyl-1-[4-methyl-5-[2-[(3-methyl-2-pyridinyl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-3-nitrobenzamide.
| Compound Name | N-[(1R)-2-methyl-1-[4-methyl-5-[2-[(3-methyl-2-pyridinyl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126130683 |
| Molecular Formula | C22H25N7O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-[(1R)-2-methyl-1-[4-methyl-5-[2-[(3-methyl-2-pyridinyl)amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-3-nitrobenzamide |
| SMILES | Cc1cccnc1NC(=O)CSc1nnc([C@H](NC(=O)c2cccc([N+](=O)[O-])c2)C(C)C)n1C |
| InChI | InChI=1S/C22H25N7O4S/c1-13(2)18(25-21(31)15-8-5-9-16(11-15)29(32)33)20-26-27-22(28(20)4)34-12-17(30)24-19-14(3)7-6-10-23-19/h5-11,13,18H,12H2,1-4H3,(H,25,31)(H,23,24,30)/t18-/m1/s1 |
| InChIKey | BMTIVUCAUFSYMK-GOSISDBHSA-N |
| XLogP | 3.28 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|