C25H25N7O4S2 — CID 126133668
N-[(1S)-2-methyl-1-[4-methyl-5-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-3-nitrobenzamide (PubChem CID 126133668) has the molecular formula C25H25N7O4S2 and a molecular weight of 551.65 g/mol. Its IUPAC name is N-[(1S)-2-methyl-1-[4-methyl-5-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-3-nitrobenzamide.
| Compound Name | N-[(1S)-2-methyl-1-[4-methyl-5-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126133668 |
| Molecular Formula | C25H25N7O4S2 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | N-[(1S)-2-methyl-1-[4-methyl-5-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-3-nitrobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1cccc([N+](=O)[O-])c1)c1nnc(SCC(=O)Nc2nc(-c3ccccc3)cs2)n1C |
| InChI | InChI=1S/C25H25N7O4S2/c1-15(2)21(28-23(34)17-10-7-11-18(12-17)32(35)36)22-29-30-25(31(22)3)38-14-20(33)27-24-26-19(13-37-24)16-8-5-4-6-9-16/h4-13,15,21H,14H2,1-3H3,(H,28,34)(H,26,27,33)/t21-/m0/s1 |
| InChIKey | QPRUAWYUPWYWFE-NRFANRHFSA-N |
| XLogP | 4.70 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|