C22H23N7O7S — CID 126149031
N-[(1S)-1-[5-[2-(4-hydroxy-3-nitroanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]-2-methylpropyl]-3-nitrobenzamide (PubChem CID 126149031) has the molecular formula C22H23N7O7S and a molecular weight of 529.54 g/mol. Its IUPAC name is N-[(1S)-1-[5-[2-(4-hydroxy-3-nitroanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]-2-methylpropyl]-3-nitrobenzamide.
| Compound Name | N-[(1S)-1-[5-[2-(4-hydroxy-3-nitroanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]-2-methylpropyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126149031 |
| Molecular Formula | C22H23N7O7S |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | N-[(1S)-1-[5-[2-(4-hydroxy-3-nitroanilino)-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]-2-methylpropyl]-3-nitrobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1cccc([N+](=O)[O-])c1)c1nnc(SCC(=O)Nc2ccc(O)c([N+](=O)[O-])c2)n1C |
| InChI | InChI=1S/C22H23N7O7S/c1-12(2)19(24-21(32)13-5-4-6-15(9-13)28(33)34)20-25-26-22(27(20)3)37-11-18(31)23-14-7-8-17(30)16(10-14)29(35)36/h4-10,12,19,30H,11H2,1-3H3,(H,23,31)(H,24,32)/t19-/m0/s1 |
| InChIKey | AWYAFOIVOUCJJU-IBGZPJMESA-N |
| XLogP | 3.19 |
| TPSA | 195.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|