C21H21N7O7S — CID 126158632
N-[(1S)-1-[3-[2-(4-hydroxy-3-nitroanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]-2-methylpropyl]-3-nitrobenzamide (PubChem CID 126158632) has the molecular formula C21H21N7O7S and a molecular weight of 515.51 g/mol. Its IUPAC name is N-[(1S)-1-[3-[2-(4-hydroxy-3-nitroanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]-2-methylpropyl]-3-nitrobenzamide.
| Compound Name | N-[(1S)-1-[3-[2-(4-hydroxy-3-nitroanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]-2-methylpropyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126158632 |
| Molecular Formula | C21H21N7O7S |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | N-[(1S)-1-[3-[2-(4-hydroxy-3-nitroanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]-2-methylpropyl]-3-nitrobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1cccc([N+](=O)[O-])c1)c1nc(SCC(=O)Nc2ccc(O)c([N+](=O)[O-])c2)n[nH]1 |
| InChI | InChI=1S/C21H21N7O7S/c1-11(2)18(23-20(31)12-4-3-5-14(8-12)27(32)33)19-24-21(26-25-19)36-10-17(30)22-13-6-7-16(29)15(9-13)28(34)35/h3-9,11,18,29H,10H2,1-2H3,(H,22,30)(H,23,31)(H,24,25,26)/t18-/m0/s1 |
| InChIKey | FAHZAHKJORQCHU-SFHVURJKSA-N |
| XLogP | 3.18 |
| TPSA | 206.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|