C21H20Cl2N6O4S — CID 126169236
N-[(1R)-1-[3-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]-2-methylpropyl]-3-nitrobenzamide (PubChem CID 126169236) has the molecular formula C21H20Cl2N6O4S and a molecular weight of 523.40 g/mol. Its IUPAC name is N-[(1R)-1-[3-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]-2-methylpropyl]-3-nitrobenzamide.
| Compound Name | N-[(1R)-1-[3-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]-2-methylpropyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126169236 |
| Molecular Formula | C21H20Cl2N6O4S |
| Molecular Weight | 523.40 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | N-[(1R)-1-[3-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]-2-methylpropyl]-3-nitrobenzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1cccc([N+](=O)[O-])c1)c1nc(SCC(=O)Nc2cccc(Cl)c2Cl)n[nH]1 |
| InChI | InChI=1S/C21H20Cl2N6O4S/c1-11(2)18(25-20(31)12-5-3-6-13(9-12)29(32)33)19-26-21(28-27-19)34-10-16(30)24-15-8-4-7-14(22)17(15)23/h3-9,11,18H,10H2,1-2H3,(H,24,30)(H,25,31)(H,26,27,28)/t18-/m1/s1 |
| InChIKey | JYTXREATHHPPCH-GOSISDBHSA-N |
| XLogP | 4.88 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|