C22H23ClN6O4S — CID 126169615
N-[(1S)-1-[3-[2-(3-chloro-2-methylanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]-2-methylpropyl]-3-nitrobenzamide (PubChem CID 126169615) has the molecular formula C22H23ClN6O4S and a molecular weight of 502.98 g/mol. Its IUPAC name is N-[(1S)-1-[3-[2-(3-chloro-2-methylanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]-2-methylpropyl]-3-nitrobenzamide.
| Compound Name | N-[(1S)-1-[3-[2-(3-chloro-2-methylanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]-2-methylpropyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126169615 |
| Molecular Formula | C22H23ClN6O4S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | N-[(1S)-1-[3-[2-(3-chloro-2-methylanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]-2-methylpropyl]-3-nitrobenzamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CSc1n[nH]c([C@@H](NC(=O)c2cccc([N+](=O)[O-])c2)C(C)C)n1 |
| InChI | InChI=1S/C22H23ClN6O4S/c1-12(2)19(25-21(31)14-6-4-7-15(10-14)29(32)33)20-26-22(28-27-20)34-11-18(30)24-17-9-5-8-16(23)13(17)3/h4-10,12,19H,11H2,1-3H3,(H,24,30)(H,25,31)(H,26,27,28)/t19-/m0/s1 |
| InChIKey | PVXJOOWYIZKNBZ-IBGZPJMESA-N |
| XLogP | 4.53 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|