C27H24N6O4S2 — CID 126178331
N-[(1R)-2-methyl-1-[3-(2-oxo-2-phenothiazin-10-ylethyl)sulfanyl-1H-1,2,4-triazol-5-yl]propyl]-3-nitrobenzamide (PubChem CID 126178331) has the molecular formula C27H24N6O4S2 and a molecular weight of 560.66 g/mol. Its IUPAC name is N-[(1R)-2-methyl-1-[3-(2-oxo-2-phenothiazin-10-ylethyl)sulfanyl-1H-1,2,4-triazol-5-yl]propyl]-3-nitrobenzamide.
| Compound Name | N-[(1R)-2-methyl-1-[3-(2-oxo-2-phenothiazin-10-ylethyl)sulfanyl-1H-1,2,4-triazol-5-yl]propyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126178331 |
| Molecular Formula | C27H24N6O4S2 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | N-[(1R)-2-methyl-1-[3-(2-oxo-2-phenothiazin-10-ylethyl)sulfanyl-1H-1,2,4-triazol-5-yl]propyl]-3-nitrobenzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1cccc([N+](=O)[O-])c1)c1nc(SCC(=O)N2c3ccccc3Sc3ccccc32)n[nH]1 |
| InChI | InChI=1S/C27H24N6O4S2/c1-16(2)24(28-26(35)17-8-7-9-18(14-17)33(36)37)25-29-27(31-30-25)38-15-23(34)32-19-10-3-5-12-21(19)39-22-13-6-4-11-20(22)32/h3-14,16,24H,15H2,1-2H3,(H,28,35)(H,29,30,31)/t24-/m1/s1 |
| InChIKey | BGANEGPXXZCDGD-XMMPIXPASA-N |
| XLogP | 5.76 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|