C20H27N7O4S — CID 126157229
N-[(1R)-2-methyl-1-[3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]propyl]-3-nitrobenzamide (PubChem CID 126157229) has the molecular formula C20H27N7O4S and a molecular weight of 461.55 g/mol. Its IUPAC name is N-[(1R)-2-methyl-1-[3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]propyl]-3-nitrobenzamide.
| Compound Name | N-[(1R)-2-methyl-1-[3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]propyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126157229 |
| Molecular Formula | C20H27N7O4S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-[(1R)-2-methyl-1-[3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]propyl]-3-nitrobenzamide |
| SMILES | CC(C)[C@@H](NC(=O)c1cccc([N+](=O)[O-])c1)c1nc(SCC(=O)N2CCN(C)CC2)n[nH]1 |
| InChI | InChI=1S/C20H27N7O4S/c1-13(2)17(21-19(29)14-5-4-6-15(11-14)27(30)31)18-22-20(24-23-18)32-12-16(28)26-9-7-25(3)8-10-26/h4-6,11,13,17H,7-10,12H2,1-3H3,(H,21,29)(H,22,23,24)/t17-/m1/s1 |
| InChIKey | FIPJLJIGGJXKSU-QGZVFWFLSA-N |
| XLogP | 1.71 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|