C22H24N6O4S — CID 126178593
N-[(1S)-2-methyl-1-[3-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]propyl]-3-nitrobenzamide (PubChem CID 126178593) has the molecular formula C22H24N6O4S and a molecular weight of 468.54 g/mol. Its IUPAC name is N-[(1S)-2-methyl-1-[3-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]propyl]-3-nitrobenzamide.
| Compound Name | N-[(1S)-2-methyl-1-[3-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]propyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126178593 |
| Molecular Formula | C22H24N6O4S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | N-[(1S)-2-methyl-1-[3-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]propyl]-3-nitrobenzamide |
| SMILES | Cc1cccc(NC(=O)CSc2n[nH]c([C@@H](NC(=O)c3cccc([N+](=O)[O-])c3)C(C)C)n2)c1 |
| InChI | InChI=1S/C22H24N6O4S/c1-13(2)19(24-21(30)15-7-5-9-17(11-15)28(31)32)20-25-22(27-26-20)33-12-18(29)23-16-8-4-6-14(3)10-16/h4-11,13,19H,12H2,1-3H3,(H,23,29)(H,24,30)(H,25,26,27)/t19-/m0/s1 |
| InChIKey | CFYLXRCUHGRALT-IBGZPJMESA-N |
| XLogP | 3.88 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|