C21H22N6O4S — CID 3382626
N-[2-methyl-1-[3-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]propyl]benzamide (PubChem CID 3382626) has the molecular formula C21H22N6O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is N-[2-methyl-1-[3-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]propyl]benzamide.
| Compound Name | N-[2-methyl-1-[3-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]propyl]benzamide |
|---|---|
| PubChem CID | 3382626 |
| Molecular Formula | C21H22N6O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N-[2-methyl-1-[3-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1H-1,2,4-triazol-5-yl]propyl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1)c1nc(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)n[nH]1 |
| InChI | InChI=1S/C21H22N6O4S/c1-13(2)18(23-20(29)14-6-4-3-5-7-14)19-24-21(26-25-19)32-12-17(28)22-15-8-10-16(11-9-15)27(30)31/h3-11,13,18H,12H2,1-2H3,(H,22,28)(H,23,29)(H,24,25,26) |
| InChIKey | GZQRUBFHNAXTJR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|