C23H21N7O4S2 — CID 126144267
N-[(1R)-1-[4-methyl-5-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 126144267) has the molecular formula C23H21N7O4S2 and a molecular weight of 523.60 g/mol. Its IUPAC name is N-[(1R)-1-[4-methyl-5-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | N-[(1R)-1-[4-methyl-5-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126144267 |
| Molecular Formula | C23H21N7O4S2 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | N-[(1R)-1-[4-methyl-5-[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1)c1nnc(SCC(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)n1C |
| InChI | InChI=1S/C23H21N7O4S2/c1-14(24-21(32)15-7-4-3-5-8-15)20-27-28-23(29(20)2)36-13-19(31)26-22-25-18(12-35-22)16-9-6-10-17(11-16)30(33)34/h3-12,14H,13H2,1-2H3,(H,24,32)(H,25,26,31)/t14-/m1/s1 |
| InChIKey | XRFMBLFQJLYREV-CQSZACIVSA-N |
| XLogP | 4.07 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|