C26H27N7O4S2 — CID 124631113
N-[(1R)-2-methyl-1-[4-methyl-5-[2-[[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]benzamide (PubChem CID 124631113) has the molecular formula C26H27N7O4S2 and a molecular weight of 565.68 g/mol. Its IUPAC name is N-[(1R)-2-methyl-1-[4-methyl-5-[2-[[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]benzamide.
| Compound Name | N-[(1R)-2-methyl-1-[4-methyl-5-[2-[[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]benzamide |
|---|---|
| PubChem CID | 124631113 |
| Molecular Formula | C26H27N7O4S2 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | N-[(1R)-2-methyl-1-[4-methyl-5-[2-[[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]benzamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CSc3nnc([C@H](NC(=O)c4ccccc4)C(C)C)n3C)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H27N7O4S2/c1-15(2)22(29-24(35)17-8-6-5-7-9-17)23-30-31-26(32(23)4)39-14-21(34)28-25-27-19(13-38-25)18-11-10-16(3)20(12-18)33(36)37/h5-13,15,22H,14H2,1-4H3,(H,29,35)(H,27,28,34)/t22-/m1/s1 |
| InChIKey | VBJBGWDFXOJJNR-JOCHJYFZSA-N |
| XLogP | 5.01 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|