C27H29N7O4S2 — CID 124581345
N-[(1S)-1-[4-ethyl-5-[2-[[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide (PubChem CID 124581345) has the molecular formula C27H29N7O4S2 and a molecular weight of 579.71 g/mol. Its IUPAC name is N-[(1S)-1-[4-ethyl-5-[2-[[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide.
| Compound Name | N-[(1S)-1-[4-ethyl-5-[2-[[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
|---|---|
| PubChem CID | 124581345 |
| Molecular Formula | C27H29N7O4S2 |
| Molecular Weight | 579.71 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | N-[(1S)-1-[4-ethyl-5-[2-[[4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
| SMILES | CCn1c(SCC(=O)Nc2nc(-c3ccc(C)c([N+](=O)[O-])c3)cs2)nnc1[C@@H](NC(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C27H29N7O4S2/c1-5-33-24(23(16(2)3)30-25(36)18-9-7-6-8-10-18)31-32-27(33)40-15-22(35)29-26-28-20(14-39-26)19-12-11-17(4)21(13-19)34(37)38/h6-14,16,23H,5,15H2,1-4H3,(H,30,36)(H,28,29,35)/t23-/m0/s1 |
| InChIKey | RQYHDACXIAQQCL-QHCPKHFHSA-N |
| XLogP | 5.50 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.71 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|