C23H16N6O4S2 — CID 2084433
2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 2084433) has the molecular formula C23H16N6O4S2 and a molecular weight of 504.55 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 2084433 |
| Molecular Formula | C23H16N6O4S2 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | 2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C23H16N6O4S2/c30-20(25-22-24-18(13-34-22)15-6-4-9-17(12-15)29(31)32)14-35-23-27-26-21(19-10-5-11-33-19)28(23)16-7-2-1-3-8-16/h1-13H,14H2,(H,24,25,30) |
| InChIKey | CFQZRNNQLFNHAP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|