C21H24N8O4S — CID 126133624
N-[(1R)-1-[4-ethyl-5-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]-3-nitrobenzamide (PubChem CID 126133624) has the molecular formula C21H24N8O4S and a molecular weight of 484.54 g/mol. Its IUPAC name is N-[(1R)-1-[4-ethyl-5-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]-3-nitrobenzamide.
| Compound Name | N-[(1R)-1-[4-ethyl-5-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126133624 |
| Molecular Formula | C21H24N8O4S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | N-[(1R)-1-[4-ethyl-5-[2-oxo-2-(pyrimidin-2-ylamino)ethyl]sulfanyl-1,2,4-triazol-3-yl]-2-methylpropyl]-3-nitrobenzamide |
| SMILES | CCn1c(SCC(=O)Nc2ncccn2)nnc1[C@H](NC(=O)c1cccc([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C21H24N8O4S/c1-4-28-18(26-27-21(28)34-12-16(30)24-20-22-9-6-10-23-20)17(13(2)3)25-19(31)14-7-5-8-15(11-14)29(32)33/h5-11,13,17H,4,12H2,1-3H3,(H,25,31)(H,22,23,24,30)/t17-/m1/s1 |
| InChIKey | IZNGFWWCADDWPC-QGZVFWFLSA-N |
| XLogP | 2.85 |
| TPSA | 157.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|