C26H30N6O6S — CID 126155231
ethyl 4-[[2-[[4-ethyl-5-[(1S)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 126155231) has the molecular formula C26H30N6O6S and a molecular weight of 554.63 g/mol. Its IUPAC name is ethyl 4-[[2-[[4-ethyl-5-[(1S)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[[4-ethyl-5-[(1S)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126155231 |
| Molecular Formula | C26H30N6O6S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | ethyl 4-[[2-[[4-ethyl-5-[(1S)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2nnc([C@@H](NC(=O)c3cccc([N+](=O)[O-])c3)C(C)C)n2CC)cc1 |
| InChI | InChI=1S/C26H30N6O6S/c1-5-31-23(22(16(3)4)28-24(34)18-8-7-9-20(14-18)32(36)37)29-30-26(31)39-15-21(33)27-19-12-10-17(11-13-19)25(35)38-6-2/h7-14,16,22H,5-6,15H2,1-4H3,(H,27,33)(H,28,34)/t22-/m0/s1 |
| InChIKey | UUYXLNJSGVCSBM-QFIPXVFZSA-N |
| XLogP | 4.24 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|