C25H28N6O6S — CID 126129669
methyl 4-[[2-[[4-ethyl-5-[(1R)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 126129669) has the molecular formula C25H28N6O6S and a molecular weight of 540.60 g/mol. Its IUPAC name is methyl 4-[[2-[[4-ethyl-5-[(1R)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[[4-ethyl-5-[(1R)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126129669 |
| Molecular Formula | C25H28N6O6S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | methyl 4-[[2-[[4-ethyl-5-[(1R)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCn1c(SCC(=O)Nc2ccc(C(=O)OC)cc2)nnc1[C@H](NC(=O)c1cccc([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C25H28N6O6S/c1-5-30-22(21(15(2)3)27-23(33)17-7-6-8-19(13-17)31(35)36)28-29-25(30)38-14-20(32)26-18-11-9-16(10-12-18)24(34)37-4/h6-13,15,21H,5,14H2,1-4H3,(H,26,32)(H,27,33)/t21-/m1/s1 |
| InChIKey | FVQQXGHCOORHBV-OAQYLSRUSA-N |
| XLogP | 3.85 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|