C27H32N6O6S — CID 126146084
propan-2-yl 3-[[2-[[4-ethyl-5-[(1R)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 126146084) has the molecular formula C27H32N6O6S and a molecular weight of 568.66 g/mol. Its IUPAC name is propan-2-yl 3-[[2-[[4-ethyl-5-[(1R)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | propan-2-yl 3-[[2-[[4-ethyl-5-[(1R)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126146084 |
| Molecular Formula | C27H32N6O6S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | propan-2-yl 3-[[2-[[4-ethyl-5-[(1R)-2-methyl-1-[(3-nitrobenzoyl)amino]propyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCn1c(SCC(=O)Nc2cccc(C(=O)OC(C)C)c2)nnc1[C@H](NC(=O)c1cccc([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C27H32N6O6S/c1-6-32-24(23(16(2)3)29-25(35)18-9-8-12-21(14-18)33(37)38)30-31-27(32)40-15-22(34)28-20-11-7-10-19(13-20)26(36)39-17(4)5/h7-14,16-17,23H,6,15H2,1-5H3,(H,28,34)(H,29,35)/t23-/m1/s1 |
| InChIKey | OSVFFZGHMUXVQL-HSZRJFAPSA-N |
| XLogP | 4.63 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|