C22H23N5O5S — CID 41020057
N-[(1S)-2-methyl-1-[4-methyl-5-[(2-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]propyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 41020057) has the molecular formula C22H23N5O5S and a molecular weight of 469.52 g/mol. Its IUPAC name is N-[(1S)-2-methyl-1-[4-methyl-5-[(2-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]propyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(1S)-2-methyl-1-[4-methyl-5-[(2-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]propyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 41020057 |
| Molecular Formula | C22H23N5O5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-[(1S)-2-methyl-1-[4-methyl-5-[(2-nitrophenyl)methylsulfanyl]-1,2,4-triazol-3-yl]propyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc2c(c1)OCO2)c1nnc(SCc2ccccc2[N+](=O)[O-])n1C |
| InChI | InChI=1S/C22H23N5O5S/c1-13(2)19(23-21(28)14-8-9-17-18(10-14)32-12-31-17)20-24-25-22(26(20)3)33-11-15-6-4-5-7-16(15)27(29)30/h4-10,13,19H,11-12H2,1-3H3,(H,23,28)/t19-/m0/s1 |
| InChIKey | KBWGOMYAPSFFFK-IBGZPJMESA-N |
| XLogP | 3.87 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|