C26H31N5O4S — CID 4312406
N-[2-methyl-1-[4-methyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 4312406) has the molecular formula C26H31N5O4S and a molecular weight of 509.63 g/mol. Its IUPAC name is N-[2-methyl-1-[4-methyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-methyl-1-[4-methyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4312406 |
| Molecular Formula | C26H31N5O4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N-[2-methyl-1-[4-methyl-5-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)CSc2nnc(C(NC(=O)c3ccc4c(c3)OCO4)C(C)C)n2C)c(C)c1 |
| InChI | InChI=1S/C26H31N5O4S/c1-14(2)22(28-25(33)18-7-8-19-20(11-18)35-13-34-19)24-29-30-26(31(24)6)36-12-21(32)27-23-16(4)9-15(3)10-17(23)5/h7-11,14,22H,12-13H2,1-6H3,(H,27,32)(H,28,33) |
| InChIKey | CSDSCMPLMIOMFP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |