C20H16Cl5N5O2S — CID 126346993
3,4-dichloro-N-[(1R)-1-[4-methyl-5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 126346993) has the molecular formula C20H16Cl5N5O2S and a molecular weight of 567.71 g/mol. Its IUPAC name is 3,4-dichloro-N-[(1R)-1-[4-methyl-5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(1R)-1-[4-methyl-5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126346993 |
| Molecular Formula | C20H16Cl5N5O2S |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 564.95 |
| IUPAC Name | 3,4-dichloro-N-[(1R)-1-[4-methyl-5-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(Cl)c(Cl)c1)c1nnc(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)n1C |
| InChI | InChI=1S/C20H16Cl5N5O2S/c1-9(26-19(32)10-3-4-11(21)12(22)5-10)18-28-29-20(30(18)2)33-8-17(31)27-16-7-14(24)13(23)6-15(16)25/h3-7,9H,8H2,1-2H3,(H,26,32)(H,27,31)/t9-/m1/s1 |
| InChIKey | BNTSLLKALSRFBR-SECBINFHSA-N |
| XLogP | 6.30 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|