C23H24Cl2N4O3S — CID 17302692
2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide (PubChem CID 17302692) has the molecular formula C23H24Cl2N4O3S and a molecular weight of 507.44 g/mol. Its IUPAC name is 2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 17302692 |
| Molecular Formula | C23H24Cl2N4O3S |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxyphenyl)acetamide |
| SMILES | C=CCn1c(CCCOc2ccc(Cl)cc2Cl)nnc1SCC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C23H24Cl2N4O3S/c1-3-11-29-21(8-5-12-32-20-10-9-16(24)13-19(20)25)27-28-23(29)33-15-22(30)26-17-6-4-7-18(14-17)31-2/h3-4,6-7,9-10,13-14H,1,5,8,11-12,15H2,2H3,(H,26,30) |
| InChIKey | PMBNINKDCJMSSC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|