C22H21BrCl2N4O2S — CID 19213506
2-[[5-[3-(2-bromo-4-chlorophenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chlorophenyl)acetamide (PubChem CID 19213506) has the molecular formula C22H21BrCl2N4O2S and a molecular weight of 556.31 g/mol. Its IUPAC name is 2-[[5-[3-(2-bromo-4-chlorophenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[[5-[3-(2-bromo-4-chlorophenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 19213506 |
| Molecular Formula | C22H21BrCl2N4O2S |
| Molecular Weight | 556.31 g/mol |
| Exact Mass | 553.99 |
| IUPAC Name | 2-[[5-[3-(2-bromo-4-chlorophenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
| SMILES | C=CCn1c(CCCOc2ccc(Cl)cc2Br)nnc1SCC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H21BrCl2N4O2S/c1-2-10-29-20(7-4-11-31-19-9-8-16(25)13-18(19)23)27-28-22(29)32-14-21(30)26-17-6-3-5-15(24)12-17/h2-3,5-6,8-9,12-13H,1,4,7,10-11,14H2,(H,26,30) |
| InChIKey | PZNRUPHYMSIAGF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.31 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|