C27H32BrClN4O2S — CID 19213556
2-[[5-[3-(4-bromo-2-methyl-5-propan-2-ylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide (PubChem CID 19213556) has the molecular formula C27H32BrClN4O2S and a molecular weight of 592.00 g/mol. Its IUPAC name is 2-[[5-[3-(4-bromo-2-methyl-5-propan-2-ylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[[5-[3-(4-bromo-2-methyl-5-propan-2-ylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19213556 |
| Molecular Formula | C27H32BrClN4O2S |
| Molecular Weight | 592.00 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | 2-[[5-[3-(4-bromo-2-methyl-5-propan-2-ylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide |
| SMILES | C=CCn1c(CCCOc2cc(C(C)C)c(Br)cc2C)nnc1SCC(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C27H32BrClN4O2S/c1-6-12-33-25(11-8-13-35-24-15-20(17(2)3)21(28)14-18(24)4)31-32-27(33)36-16-26(34)30-23-10-7-9-22(29)19(23)5/h6-7,9-10,14-15,17H,1,8,11-13,16H2,2-5H3,(H,30,34) |
| InChIKey | BAVIKJBDQOLMHQ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.00 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|