C24H26BrClN4O2S — CID 19213468
2-[[5-[3-(4-bromo-2-methylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide (PubChem CID 19213468) has the molecular formula C24H26BrClN4O2S and a molecular weight of 549.92 g/mol. Its IUPAC name is 2-[[5-[3-(4-bromo-2-methylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[[5-[3-(4-bromo-2-methylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19213468 |
| Molecular Formula | C24H26BrClN4O2S |
| Molecular Weight | 549.92 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | 2-[[5-[3-(4-bromo-2-methylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chloro-2-methylphenyl)acetamide |
| SMILES | C=CCn1c(CCCOc2ccc(Br)cc2C)nnc1SCC(=O)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C24H26BrClN4O2S/c1-4-12-30-22(9-6-13-32-21-11-10-18(25)14-16(21)2)28-29-24(30)33-15-23(31)27-20-8-5-7-19(26)17(20)3/h4-5,7-8,10-11,14H,1,6,9,12-13,15H2,2-3H3,(H,27,31) |
| InChIKey | OGOHTMJNZKUMQA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.92 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|