C26H30Cl2N4O2S — CID 19213598
2-[[5-[3-(4-tert-butylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4-dichlorophenyl)acetamide (PubChem CID 19213598) has the molecular formula C26H30Cl2N4O2S and a molecular weight of 533.53 g/mol. Its IUPAC name is 2-[[5-[3-(4-tert-butylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-[[5-[3-(4-tert-butylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 19213598 |
| Molecular Formula | C26H30Cl2N4O2S |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 2-[[5-[3-(4-tert-butylphenoxy)propyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4-dichlorophenyl)acetamide |
| SMILES | C=CCn1c(CCCOc2ccc(C(C)(C)C)cc2)nnc1SCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H30Cl2N4O2S/c1-5-14-32-23(7-6-15-34-20-11-8-18(9-12-20)26(2,3)4)30-31-25(32)35-17-24(33)29-22-13-10-19(27)16-21(22)28/h5,8-13,16H,1,6-7,14-15,17H2,2-4H3,(H,29,33) |
| InChIKey | GYIDCJPSPMNGNQ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|