C21H19Cl2N5O2S — CID 126360125
N-[[5-[2-(2,5-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 126360125) has the molecular formula C21H19Cl2N5O2S and a molecular weight of 476.39 g/mol. Its IUPAC name is N-[[5-[2-(2,5-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | N-[[5-[2-(2,5-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 126360125 |
| Molecular Formula | C21H19Cl2N5O2S |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | N-[[5-[2-(2,5-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | C=CCn1c(CNC(=O)c2ccccc2)nnc1SCC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H19Cl2N5O2S/c1-2-10-28-18(12-24-20(30)14-6-4-3-5-7-14)26-27-21(28)31-13-19(29)25-17-11-15(22)8-9-16(17)23/h2-9,11H,1,10,12-13H2,(H,24,30)(H,25,29) |
| InChIKey | AXIUSDOCDXHRAH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|