C21H18Cl2FN5O2S — CID 21379431
2,4-dichloro-N-[[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 21379431) has the molecular formula C21H18Cl2FN5O2S and a molecular weight of 494.38 g/mol. Its IUPAC name is 2,4-dichloro-N-[[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 21379431 |
| Molecular Formula | C21H18Cl2FN5O2S |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 2,4-dichloro-N-[[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | C=CCn1c(CNC(=O)c2ccc(Cl)cc2Cl)nnc1SCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C21H18Cl2FN5O2S/c1-2-9-29-18(11-25-20(31)14-8-7-13(22)10-15(14)23)27-28-21(29)32-12-19(30)26-17-6-4-3-5-16(17)24/h2-8,10H,1,9,11-12H2,(H,25,31)(H,26,30) |
| InChIKey | BNGTVPAEEZWNRT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|