C24H26ClN5O2S — CID 126360381
2-chloro-N-[[5-[2-oxo-2-(2-propan-2-ylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 126360381) has the molecular formula C24H26ClN5O2S and a molecular weight of 484.03 g/mol. Its IUPAC name is 2-chloro-N-[[5-[2-oxo-2-(2-propan-2-ylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 2-chloro-N-[[5-[2-oxo-2-(2-propan-2-ylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 126360381 |
| Molecular Formula | C24H26ClN5O2S |
| Molecular Weight | 484.03 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 2-chloro-N-[[5-[2-oxo-2-(2-propan-2-ylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | C=CCn1c(CNC(=O)c2ccccc2Cl)nnc1SCC(=O)Nc1ccccc1C(C)C |
| InChI | InChI=1S/C24H26ClN5O2S/c1-4-13-30-21(14-26-23(32)18-10-5-7-11-19(18)25)28-29-24(30)33-15-22(31)27-20-12-8-6-9-17(20)16(2)3/h4-12,16H,1,13-15H2,2-3H3,(H,26,32)(H,27,31) |
| InChIKey | AWKGKZUMEYMJNO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.03 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|