C24H23Cl2N5O4S — CID 126363941
ethyl 3-[[2-[[5-[[(2,4-dichlorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 126363941) has the molecular formula C24H23Cl2N5O4S and a molecular weight of 548.45 g/mol. Its IUPAC name is ethyl 3-[[2-[[5-[[(2,4-dichlorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 3-[[2-[[5-[[(2,4-dichlorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126363941 |
| Molecular Formula | C24H23Cl2N5O4S |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 547.08 |
| IUPAC Name | ethyl 3-[[2-[[5-[[(2,4-dichlorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | C=CCn1c(CNC(=O)c2ccc(Cl)cc2Cl)nnc1SCC(=O)Nc1cccc(C(=O)OCC)c1 |
| InChI | InChI=1S/C24H23Cl2N5O4S/c1-3-10-31-20(13-27-22(33)18-9-8-16(25)12-19(18)26)29-30-24(31)36-14-21(32)28-17-7-5-6-15(11-17)23(34)35-4-2/h3,5-9,11-12H,1,4,10,13-14H2,2H3,(H,27,33)(H,28,32) |
| InChIKey | MIKKMIBVPOFLCQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|