C25H26ClN5O4S — CID 21379289
propyl 3-[[2-[[5-[[(3-chlorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 21379289) has the molecular formula C25H26ClN5O4S and a molecular weight of 528.03 g/mol. Its IUPAC name is propyl 3-[[2-[[5-[[(3-chlorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | propyl 3-[[2-[[5-[[(3-chlorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 21379289 |
| Molecular Formula | C25H26ClN5O4S |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | propyl 3-[[2-[[5-[[(3-chlorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | C=CCn1c(CNC(=O)c2cccc(Cl)c2)nnc1SCC(=O)Nc1cccc(C(=O)OCCC)c1 |
| InChI | InChI=1S/C25H26ClN5O4S/c1-3-11-31-21(15-27-23(33)17-7-5-9-19(26)13-17)29-30-25(31)36-16-22(32)28-20-10-6-8-18(14-20)24(34)35-12-4-2/h3,5-10,13-14H,1,4,11-12,15-16H2,2H3,(H,27,33)(H,28,32) |
| InChIKey | QDIBUNIVRVRNIO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|