C22H21Cl2N5O2S — CID 126357379
N-[[5-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3-methylbenzamide (PubChem CID 126357379) has the molecular formula C22H21Cl2N5O2S and a molecular weight of 490.42 g/mol. Its IUPAC name is N-[[5-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3-methylbenzamide.
| Compound Name | N-[[5-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 126357379 |
| Molecular Formula | C22H21Cl2N5O2S |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | N-[[5-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3-methylbenzamide |
| SMILES | C=CCn1c(CNC(=O)c2cccc(C)c2)nnc1SCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H21Cl2N5O2S/c1-3-9-29-19(12-25-21(31)15-6-4-5-14(2)10-15)27-28-22(29)32-13-20(30)26-18-8-7-16(23)11-17(18)24/h3-8,10-11H,1,9,12-13H2,2H3,(H,25,31)(H,26,30) |
| InChIKey | URXXUYOGGGQDQF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|