C23H20Cl3N5O2S — CID 3929352
3-(2-chlorophenyl)-N-[[5-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide (PubChem CID 3929352) has the molecular formula C23H20Cl3N5O2S and a molecular weight of 536.87 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[[5-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[[5-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 3929352 |
| Molecular Formula | C23H20Cl3N5O2S |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[[5-[2-(2,4-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide |
| SMILES | C=CCn1c(CNC(=O)C=Cc2ccccc2Cl)nnc1SCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H20Cl3N5O2S/c1-2-11-31-20(13-27-21(32)10-7-15-5-3-4-6-17(15)25)29-30-23(31)34-14-22(33)28-19-9-8-16(24)12-18(19)26/h2-10,12H,1,11,13-14H2,(H,27,32)(H,28,33) |
| InChIKey | OLRCLCCDNFWLAN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|