C24H24ClN5O2S — CID 5124978
3-(2-chlorophenyl)-N-[[5-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide (PubChem CID 5124978) has the molecular formula C24H24ClN5O2S and a molecular weight of 482.01 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[[5-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[[5-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 5124978 |
| Molecular Formula | C24H24ClN5O2S |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[[5-[2-(4-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide |
| SMILES | C=CCn1c(CNC(=O)C=Cc2ccccc2Cl)nnc1SCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H24ClN5O2S/c1-3-14-30-21(15-26-22(31)13-10-18-6-4-5-7-20(18)25)28-29-24(30)33-16-23(32)27-19-11-8-17(2)9-12-19/h3-13H,1,14-16H2,2H3,(H,26,31)(H,27,32) |
| InChIKey | COOWKGAJAQDUCI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|