C24H23Cl2N5O3S — CID 4534349
N-[[5-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3-(2-chlorophenyl)prop-2-enamide (PubChem CID 4534349) has the molecular formula C24H23Cl2N5O3S and a molecular weight of 532.45 g/mol. Its IUPAC name is N-[[5-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3-(2-chlorophenyl)prop-2-enamide.
| Compound Name | N-[[5-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3-(2-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4534349 |
| Molecular Formula | C24H23Cl2N5O3S |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | N-[[5-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3-(2-chlorophenyl)prop-2-enamide |
| SMILES | C=CCn1c(CNC(=O)C=Cc2ccccc2Cl)nnc1SCC(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C24H23Cl2N5O3S/c1-3-12-31-21(14-27-22(32)11-8-16-6-4-5-7-18(16)26)29-30-24(31)35-15-23(33)28-19-13-17(25)9-10-20(19)34-2/h3-11,13H,1,12,14-15H2,2H3,(H,27,32)(H,28,33) |
| InChIKey | NZNYVHYSUZHLGR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|