C23H24IN5O2S — CID 126362420
N-[[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3-methylbenzamide (PubChem CID 126362420) has the molecular formula C23H24IN5O2S and a molecular weight of 561.45 g/mol. Its IUPAC name is N-[[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3-methylbenzamide.
| Compound Name | N-[[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 126362420 |
| Molecular Formula | C23H24IN5O2S |
| Molecular Weight | 561.45 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | N-[[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-3-methylbenzamide |
| SMILES | C=CCn1c(CNC(=O)c2cccc(C)c2)nnc1SCC(=O)Nc1ccc(I)cc1C |
| InChI | InChI=1S/C23H24IN5O2S/c1-4-10-29-20(13-25-22(31)17-7-5-6-15(2)11-17)27-28-23(29)32-14-21(30)26-19-9-8-18(24)12-16(19)3/h4-9,11-12H,1,10,13-14H2,2-3H3,(H,25,31)(H,26,30) |
| InChIKey | HRICYAMQHXOOLT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|