C21H19ClN4O2S — CID 3969546
4-chloro-N-[(5-phenacylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)methyl]benzamide (PubChem CID 3969546) has the molecular formula C21H19ClN4O2S and a molecular weight of 426.93 g/mol. Its IUPAC name is 4-chloro-N-[(5-phenacylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)methyl]benzamide.
| Compound Name | 4-chloro-N-[(5-phenacylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 3969546 |
| Molecular Formula | C21H19ClN4O2S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 4-chloro-N-[(5-phenacylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)methyl]benzamide |
| SMILES | C=CCn1c(CNC(=O)c2ccc(Cl)cc2)nnc1SCC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H19ClN4O2S/c1-2-12-26-19(13-23-20(28)16-8-10-17(22)11-9-16)24-25-21(26)29-14-18(27)15-6-4-3-5-7-15/h2-11H,1,12-14H2,(H,23,28) |
| InChIKey | YQHGIWOMEOLHEN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|